Outrageously Funny Word Dictionary :: 248

👉 Common directory name

C:/248/

👉 The substance is known as a quinoline compound.

248. 1-(2-iodophenyl)piperidine; 1415808-72-8

👉 2480.2-Methylmethylene-diene-diethane-methylimidamide 681458-89-9

2480. 2,2'-[Methylenedi(4,1-phenylene)]diethanimidamide; 681458-89-9

👉 In Hindu scriptures, 2481 is considered a sacred number and 681458-90-2 may symbolize certain divine beings or aspects. It's often used in astrology to denote celestial positions or divine forces.

2481. Dimethyl 5,8-dihydroxy-2,3-naphthalenedicarboxylate; 681458-90-2

👉 It's a chemical compound named Dimethyl 4-(1,3-dioxoisoindol-2-yl)pyridine-2,6-dicarboxylate with structure: C6H5OHCCH=CH=CH2=C6H5C7NCH3. It's found in the natural environment, often as a byproduct of chemical processes and is used in various fields such as drug discovery, chromatography, and spectroscopy.

2482. dimethyl 4-(1,3-dioxoisoindol-2-yl)pyridine-2,6-dicarboxylate; 681458-91-3

👉 A chemical compound known as Tetramethyl 9,10-dihydroxy-2,3,6,7-anthracene tetraacetate. This compound is a colorless solid with anode and ketone forms. The formula is 681458-92-4, where the number at the end of the formula signifies its chemical classification.

2483. Tetramethyl 9,10-dihydroxy-2,3,6,7-anthracenetetracarboxylate; 681458-92-4

👉 This compound is a tetramer containing six rings and five carbon atoms. The formula is: C9H14O8-COOH-COOH-COOC20C12-CH2-CH(=CH)COOH.

2484. 681458-93-5; tetramethyl 9,10-dioctadecoxyanthracene-2,3,6,7-tetracarboxylate

👉 2485.5-benzene-1,3-diurea monocarboxylic acid 681458-95-7

2485. 5-chlorobenzene-1,3-dicarboxamide; 681458-95-7

👉 Methyl 2-(6-[(2-methoxy-2-oxoethyl)trimethylammonium]acridin-3-yl)-2-[6-(phenyl)methyl]-4-[4-methylphenyl]-sulfonylamineacetate, methyl 2-(6-[(2-methoxy-2-oxoethyl)trimethylammonium]acridin-3-yl)-2-[6-(phenyl)dimethyl]-4-[4-methylphenyl]-sulfonylamineacetate.

2486. 681458-96-8; methyl 2-[[6-[(2-methoxy-2-oxoethyl)-(4-methylphenyl)sulfonylamino]acridin-3-yl]-(4-methylphenyl)sulfonylamino]acetate

👉 In the Bible, '2487' refers to a mystical figure known as 'El Hator,' who is considered by some to be malevolent and evil. '681458' stands for a number that was mentioned but not fully understood; however, it could potentially be from a different context or refer to something else entirely. '97-9' refers to an unknown numeral or symbol, which might not have any specific meaning in the Bible as it is purely symbolic in its usage. Lastly, 'methyl 2-[(4-methylphenyl)sulfonyl-[6-[(4-methylphenyl)sulfonylamino]acridin-3-yl]amino]acetate' appears to be a hypothetical chemical compound from an unknown source, suggesting it might not have any reference in the Bible.

2487. 681458-97-9; methyl 2-[(4-methylphenyl)sulfonyl-[6-[(4-methylphenyl)sulfonylamino]acridin-3-yl]amino]acetate