Outrageously Funny Word Definitions :: 1554

👉 Common directory name

C:/1554/

👉 It's a substance found in various environments that contains an acid.

1554. Methyl (decyldisulfanyl)acetate; 674806-35-0

👉

Okay, let's tackle this problem. The user wants me to define a pretty specific chemical compound: '1554. Methyl (decyldisulfanyl)acetate; 674806 35 0' in a hilarious and informative way. Then create an edgy or unsettling example sentence using it. Alright, first things first, I need to parse the chemical name correctly. The compound is called Methyl (decyldisulfanyl) acetate. Let's break that down. Acetate usually refers to something derived from acetic acid, so methyl acetate would be CH3COOCH2CH3 or similar. But here there's a disulfanyl group: decyldisulfanyl. Disulfanyl is -S-S- in ethane otherwise, but with alkyl groups attached. Decylic means ten carbons long. So maybe the structure is CH3-C(=O)-O-S-S-(decyl groups)? Wait, or is it (decyldisulfanyl) as a substituent on the acetate? Wait, the name might be structured such that there's a methyl group attached to either the acetyl part or the disulfanyl part. Let me think. The IUPAC name would help here, but since it's given as 'Methyl (decyldisulfanyl)acetate', perhaps it's Methyl acetate where one of the groups is a decyldisulfanyl moiety. Alternatively, maybe the compound is CH3-O-acetyl-S-(CH2)8-SH? No, that's dithiolate. Wait, decyldisulfanyl would be S-S with two alkyl groups on each sulfur? Or perhaps it's -SCH2CH2S-CH2CH2CH2...? Hmm. Wait, "decyldisulfanyl" suggests a disulfide chain where the terminal sulfurs are attached to chains. Wait, maybe decyldisulfanyl is S-S with two decyl groups on each sulfur? So like CH2CH2(CH2)6S-S-S(CH2)8SCH2CH2(CH2)6H? But that seems long. Alternatively, it's a disulfide bond (—S-S—) between two decyl groups: Decanoyl disulfide? Wait, the name is Methyl (decyldisulfanyl) acetate. So maybe the structure is CH3-O-acetyl group with a decyldisulfanyl substituent. Let me try to draw this. Acetate is CH3COO-. If there's a methyl group attached somewhere else: "Methyl" prefix, then (decyldisulfanyl) as a substituent on the acetate's oxygen? Or maybe the disulfanyl part replaces an -OR group? Alternatively, perhaps it's Methyl decyldisulfide, but with an acetate. Wait, decyldisulfane would be S-S alkyls. So methyl (decyldisulfanyl) acetate could mean that there's a methyl ester (-OCH3), and the rest is (decyldisulfanyl) part. Wait, maybe it's analogous to sodium octadecyl sulfate, but here with disulfide bonds instead of sulfates. Hmm. Alternatively, perhaps the compound is CH3-O-C(=O)-S-S-(decyl groups). Wait, decylic acid would be HOOC-(CH2)8-COOH? No, that's adipic acid. Alternatively, maybe it's Methyl 3-sulfanylbutanoyl sulfate? Not sure. Let's try to parse the name step by step. Breaking down "Methyl (decyldisulfanyl) acetate". The word parts are: - Methyl: substituent -CH3 - (decyldisulfanyl): a group consisting of two sulfurs linked together, each attached to decyl groups. Decylic is C12H25. So maybe the structure is CH3-O-C(=O)-S-S-(C11H23). Wait, but that's not balanced. Alternatively, perhaps it's (decyldisulfanyl) as an acyl group modified by methylation. Alternatively, think of it as a disulfide bond attached to acetate. So maybe the structure is CH3-O-C(=O)-S-S-CH2(CH2)8-SH? No, that would be a dithiol, but decyldisulfanyl suggests two sulfurs with alkyls. Wait, perhaps it's similar to sodium lauryl sulfate (SDS), which has a sulfate group attached to a hydrocarbon chain. In this case, instead of sulfate (-SO4^2-), we have a disulfide (-S-S-) linked to decyl groups. So the structure would be CH3-O-C(=O)-S-S-(C11H23). Wait, but that leaves one sulfur unaccounted for. Maybe each sulfur is attached to a decyl chain: S-(CH2)8-S-S-(CH2)8-? No, that's not right. Alternatively, the disulfide bond connects two decyl groups: CH3-O-C(=O)-S-S-. Wait, but that would be an acetic acid derivative with a disulfide bridge. So perhaps Methyl (decyldisulfanyl) acetate is methyl octanoyl disulfate? Not sure. Alternatively, maybe the correct structure is CH3-O-C(=O)-SCH2CH2(CH2)6S-. That would be an acetyl group connected via oxygen to a thioester of decyltiosyl mercaptane. But that's getting complicated. Wait, perhaps "decyldisulfanyl" refers to -S-S- with two decyl groups attached. So each sulfur is linked to a decyl chain. So the structure would be CH3-O-C(=O)-SCH2(CH2)6CH2-SH? No, that's dithiol again. Alternatively, maybe it's (decyldisulfanyl) as an acyloxy group: O-S-(CH2)8- S-. But that doesn't quite make sense. Maybe the correct approach is to look at common disulfide compounds. Sodium dodecyl sulfate (SDS) has a sulfate group attached to a hydrocarbon chain. So in this case, replacing sulfate with something else. Wait, maybe it's similar to sulfated esters but using disulfides. Alternatively, considering that "decyldisulfanyl" is the part that's being methylated. Wait, perhaps the compound is CH3-O-C(=O)-S-S-. But then where are the decyl groups? Maybe each sulfur atom has a decyl chain attached. So S-(CH2)8- and -SH on one end? No, that would be dithiolate. Alternatively, maybe it's (CH2)n-S-S-(CH2)n-, with n=10 for decylic. So the disulfide bridge is between two 10-carbon chains. Then connected to an acetyl group via oxygen. So Methyl (decyldisulfanyl) acetate would be CH3-O-C(=O)-S-S-(C9H20). Wait