Outrageously Funny Word Dictionary :: 542

👉 Common directory name

C:/542/

👉 It's a chemical compound found in petroleum products.

542. 1-Pentanol, 2-ethyl-4-methyl-, nitrate; 803699-63-0

👉 The word is "542000 861210 - 32 - 4".

542000. 861210-32-4; 5-(6,7-dichloro-2,3-dihydro-1,4-benzodioxin-5-yl)-2-(methylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine

👉 The chemical formula is C13H18NO3.

542001. 338404-47-0; N-{2-[(2,4-dichlorophenyl)formamido]ethyl}-2,5-bis(2,2,2-trifluoroethoxy)benzamide

👉 It's a compound with the chemical formula C10H14NO2 and ethylamine ester.

542002. 478031-55-9; ethyl2-{[6-(methanesulfonylmethyl)-2-(pyridin-2-yl)pyrimidin-4-yl]sulfanyl}acetate

👉 "542003." is a number, not a word.

542003. 2089277-50-7; 2-[(oxan-4-yl)amino]phenolhydrochloride

👉 The word is '542004. 866133-60-0'.

542004. 866133-60-0; 4-[(E)-2-(2-ethoxyphenyl)ethenyl]-8-(trifluoromethoxy)-2H,3H-thieno[3,2-c]quinoline

👉 It's an organic compound with four carbon atoms, a methyl group (ethyl), and one fluorine atom bonded to a nitrogen atom in position 3. It is composed of a 5-carbon chain, alternating between three pairs of double bonds and two triple bonds. The formula is: CH2N(0)-CH2N-CH2-CH=NH-CH3, where the subscript '5' stands for five carbons.

542005. 4-(4-chlorophenyl)-2-(4-fluorophenyl)-4-oxobutanenitrile; 344280-72-4

👉 The chemical is a benzothiazoline compound named 542006. Its formula is Methyl3-{2-[(2,5-dichlorophenyl)sulfanyl]acetamido}thiophene-2-carboxylate.

542006. 477887-65-3; methyl3-{2-[(2,5-dichlorophenyl)sulfanyl]acetamido}thiophene-2-carboxylate

👉 The word '542007. 860787-95-7' is a chemical structure describing an N-([-(3-methylphenyl)-5H-indeno[1,2-c]pyridazin-5-ylidene]) hydroxyamine.

542007. 860787-95-7; N-[(5Z)-3-(3-methylphenyl)-5H-indeno[1,2-c]pyridazin-5-ylidene]hydroxylamine