What is the definition of 514?

Common directory name

C:/514/

Common directory name

C:/514cu/

The chemical is known as 514.2-methoxymethylphenylenecarboxylic acid, also known as phenylquinolinacarboxylic acid with 2-(3-methylene)phenyl group. It has a melting point of -86.7°C.

514. 2-(3-Methoxyl)phenylquinoline; 24641-29-0

The chemical name is methanamine chloride, with molecular weight 794.037.

514001. (2,3-DIHYDROBENZOFURAN-6-YL)METHANAMINEHCL; 1820906-52-2

It refers to a colorless, odorless gas that is toxic and can cause respiratory problems when breathed in.

514000. 2-(4-hydroxyphenyl)-2-(methylamino)acetonitrile; 1039815-62-7

The chemical is a synthetic drug used in anti-spam and insect repellent.

514002. (1S,2S)-1-AMINO-1-(2,5-DIFLUOROPHENYL)PROPAN-2-OL; 1270276-78-2

This substance is a 5,14004-320422 chemical compound composed of five 5's, a zirconium atom, and an amino group at position 17. This molecule is commonly known as 5-isopropylideneimidazolidinone.

514004. 320422-91-1; (5Z)-5-[(5-bromo-2-ethoxyphenyl)methylidene]-3-[(pyridin-3-yl)methyl]-2-sulfanylideneimidazolidin-4-one

In a chemical analysis, this molecule is known as methyl2-[4-(3-chloro-5-fluorophenyl)phenyl]acetic acid.

514005. 1820613-54-4; methyl2-[4-(3-chloro-5-fluorophenyl)phenyl]acetate

It's a chemical compound named C26H30NO4NCH2CH2OCH(O)CH3.

514007. 1820735-48-5; 2-AMINO-5-(2-METHYLPROPYL)-1,3-OXAZOLE-4-CARBOXYLICACID

The answer is 514008. 6-methyl-5-isoxazolidinone, pyridine derivative, 1255860-55-9.

514008. 6-(Pyridin-4-yl)isoquinoline; 1255860-55-9